C17H38N2 — CID 142420911
1-(2,2-dimethylpropyl)azetidine;ethane;1-propylpyrrolidine (PubChem CID 142420911) has the molecular formula C17H38N2 and a molecular weight of 270.50 g/mol. Its IUPAC name is 1-(2,2-dimethylpropyl)azetidine;ethane;1-propylpyrrolidine.
| Compound Name | 1-(2,2-dimethylpropyl)azetidine;ethane;1-propylpyrrolidine |
|---|---|
| PubChem CID | 142420911 |
| Molecular Formula | C17H38N2 |
| Molecular Weight | 270.50 g/mol |
| Exact Mass | 270.30 |
| IUPAC Name | 1-(2,2-dimethylpropyl)azetidine;ethane;1-propylpyrrolidine |
| SMILES | CC.CC(C)(C)CN1CCC1.CCCN1CCCC1 |
| InChI | InChI=1S/C8H17N.C7H15N.C2H6/c1-8(2,3)7-9-5-4-6-9;1-2-5-8-6-3-4-7-8;1-2/h4-7H2,1-3H3;2-7H2,1H3;1-2H3 |
| InChIKey | VRXSATJGOSSQKC-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.50 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |