About [(Z)-[amino-[3-(4-chlorophenyl)-3-fluorocyclobutyl]methylidene]amino] 2-chloroacetate;ethane
[(Z)-[amino-[3-(4-chlorophenyl)-3-fluorocyclobutyl]methylidene]amino] 2-chloroacetate;ethane (PubChem CID 142421482) has the molecular formula C15H19Cl2FN2O2
and a molecular weight of 349.23 g/mol. Its IUPAC name is [(Z)-[amino-[3-(4-chlorophenyl)-3-fluorocyclobutyl]methylidene]amino] 2-chloroacetate;ethane.
Molecular Properties
| Compound Name | [(Z)-[amino-[3-(4-chlorophenyl)-3-fluorocyclobutyl]methylidene]amino] 2-chloroacetate;ethane |
| PubChem CID | 142421482 |
| Molecular Formula | C15H19Cl2FN2O2 |
| Molecular Weight | 349.23 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | [(Z)-[amino-[3-(4-chlorophenyl)-3-fluorocyclobutyl]methylidene]amino] 2-chloroacetate;ethane |
| SMILES | CC.N/C(=N\OC(=O)CCl)C1CC(F)(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C13H13Cl2FN2O2.C2H6/c14-7-11(19)20-18-12(17)8-5-13(16,6-8)9-1-3-10(15)4-2-9;1-2/h1-4,8H,5-7H2,(H2,17,18);1-2H3 |
| InChIKey | QTLXWRBEXILLLT-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.23 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-[amino-[3-(4-chlorophenyl)-3-fluorocyclobutyl]methylidene]amino] 2-chloroacetate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-[amino-[3-(4-chlorophenyl)-3-fluorocyclobutyl]methylidene]amino] 2-chloroacetate;ethane?
The IUPAC name of [(Z)-[amino-[3-(4-chlorophenyl)-3-fluorocyclobutyl]methylidene]amino] 2-chloroacetate;ethane (CID 142421482) is [(Z)-[amino-[3-(4-chlorophenyl)-3-fluorocyclobutyl]methylidene]amino] 2-chloroacetate;ethane.
What is the SMILES notation for [(Z)-[amino-[3-(4-chlorophenyl)-3-fluorocyclobutyl]methylidene]amino] 2-chloroacetate;ethane?
The canonical SMILES for [(Z)-[amino-[3-(4-chlorophenyl)-3-fluorocyclobutyl]methylidene]amino] 2-chloroacetate;ethane is CC.N/C(=N\OC(=O)CCl)C1CC(F)(c2ccc(Cl)cc2)C1.
What is the InChIKey of [(Z)-[amino-[3-(4-chlorophenyl)-3-fluorocyclobutyl]methylidene]amino] 2-chloroacetate;ethane?
The InChIKey is QTLXWRBEXILLLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13Cl2FN2O2.C2H6/c14-7-11(19)20-18-12(17)8-5-13(16,6-8)9-1-3-10(15)4-2-9;1-2/h1-4,8H,5-7H2,(H2,17,18);1-2H3.
What are the key properties of [(Z)-[amino-[3-(4-chlorophenyl)-3-fluorocyclobutyl]methylidene]amino] 2-chloroacetate;ethane?
[(Z)-[amino-[3-(4-chlorophenyl)-3-fluorocyclobutyl]methylidene]amino] 2-chloroacetate;ethane has a molecular weight of 349.23 g/mol, XLogP of 4.00, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-[amino-[3-(4-chlorophenyl)-3-fluorocyclobutyl]methylidene]amino] 2-chloroacetate;ethane is sourced from PubChem (CID 142421482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).