C14H14ClN3O — CID 142421498
5-(chloromethyl)-3-[(1S,5R)-3-phenyl-3-azabicyclo[3.1.0]hexan-6-yl]-1,2,4-oxadiazole (PubChem CID 142421498) has the molecular formula C14H14ClN3O and a molecular weight of 275.74 g/mol. Its IUPAC name is 5-(chloromethyl)-3-[(1S,5R)-3-phenyl-3-azabicyclo[3.1.0]hexan-6-yl]-1,2,4-oxadiazole.
| Compound Name | 5-(chloromethyl)-3-[(1S,5R)-3-phenyl-3-azabicyclo[3.1.0]hexan-6-yl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 142421498 |
| Molecular Formula | C14H14ClN3O |
| Molecular Weight | 275.74 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 5-(chloromethyl)-3-[(1S,5R)-3-phenyl-3-azabicyclo[3.1.0]hexan-6-yl]-1,2,4-oxadiazole |
| SMILES | ClCc1nc(C2[C@H]3CN(c4ccccc4)C[C@@H]23)no1 |
| InChI | InChI=1S/C14H14ClN3O/c15-6-12-16-14(17-19-12)13-10-7-18(8-11(10)13)9-4-2-1-3-5-9/h1-5,10-11,13H,6-8H2/t10-,11+,13? |
| InChIKey | CNYDEWSAEHOYBY-QYJAPNMZSA-N |
| XLogP | 2.66 |
| TPSA | 42.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.74 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|