C21H16F2N6O2 — CID 142421615
1-[[3-[(1R,5R,6S)-3-(2,3-difluorophenyl)-6-bicyclo[3.1.0]hex-2-enyl]-1,2,4-oxadiazol-5-yl]methyl]-7-methylpurin-6-one (PubChem CID 142421615) has the molecular formula C21H16F2N6O2 and a molecular weight of 422.40 g/mol. Its IUPAC name is 1-[[3-[(1R,5R,6S)-3-(2,3-difluorophenyl)-6-bicyclo[3.1.0]hex-2-enyl]-1,2,4-oxadiazol-5-yl]methyl]-7-methylpurin-6-one.
| Compound Name | 1-[[3-[(1R,5R,6S)-3-(2,3-difluorophenyl)-6-bicyclo[3.1.0]hex-2-enyl]-1,2,4-oxadiazol-5-yl]methyl]-7-methylpurin-6-one |
|---|---|
| PubChem CID | 142421615 |
| Molecular Formula | C21H16F2N6O2 |
| Molecular Weight | 422.40 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | 1-[[3-[(1R,5R,6S)-3-(2,3-difluorophenyl)-6-bicyclo[3.1.0]hex-2-enyl]-1,2,4-oxadiazol-5-yl]methyl]-7-methylpurin-6-one |
| SMILES | Cn1cnc2ncn(Cc3nc([C@@H]4[C@H]5C=C(c6cccc(F)c6F)C[C@H]54)no3)c(=O)c21 |
| InChI | InChI=1S/C21H16F2N6O2/c1-28-8-24-20-18(28)21(30)29(9-25-20)7-15-26-19(27-31-15)16-12-5-10(6-13(12)16)11-3-2-4-14(22)17(11)23/h2-5,8-9,12-13,16H,6-7H2,1H3/t12-,13+,16+/m0/s1 |
| InChIKey | QWJYOLGDDWGWEX-WOSRLPQWSA-N |
| XLogP | 2.66 |
| TPSA | 91.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.40 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |