C23H19N5O3 — CID 142421905
5-methyl-3-[[3-[(1R,5R,6S)-3-phenyl-6-bicyclo[3.1.0]hex-2-enyl]-1,2,4-oxadiazol-5-yl]methyl]pyrido[3,2-d]pyrimidine-4,6-dione (PubChem CID 142421905) has the molecular formula C23H19N5O3 and a molecular weight of 413.44 g/mol. Its IUPAC name is 5-methyl-3-[[3-[(1R,5R,6S)-3-phenyl-6-bicyclo[3.1.0]hex-2-enyl]-1,2,4-oxadiazol-5-yl]methyl]pyrido[3,2-d]pyrimidine-4,6-dione.
| Compound Name | 5-methyl-3-[[3-[(1R,5R,6S)-3-phenyl-6-bicyclo[3.1.0]hex-2-enyl]-1,2,4-oxadiazol-5-yl]methyl]pyrido[3,2-d]pyrimidine-4,6-dione |
|---|---|
| PubChem CID | 142421905 |
| Molecular Formula | C23H19N5O3 |
| Molecular Weight | 413.44 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | 5-methyl-3-[[3-[(1R,5R,6S)-3-phenyl-6-bicyclo[3.1.0]hex-2-enyl]-1,2,4-oxadiazol-5-yl]methyl]pyrido[3,2-d]pyrimidine-4,6-dione |
| SMILES | Cn1c(=O)ccc2ncn(Cc3nc([C@@H]4[C@H]5C=C(c6ccccc6)C[C@H]54)no3)c(=O)c21 |
| InChI | InChI=1S/C23H19N5O3/c1-27-19(29)8-7-17-21(27)23(30)28(12-24-17)11-18-25-22(26-31-18)20-15-9-14(10-16(15)20)13-5-3-2-4-6-13/h2-9,12,15-16,20H,10-11H2,1H3/t15-,16+,20+/m0/s1 |
| InChIKey | OUOJOESQQFDWPE-RZQQEMMASA-N |
| XLogP | 2.34 |
| TPSA | 95.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.44 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |