C21H15F3N6O2 — CID 142421922
7-methyl-1-[[3-[(1R,5R,6S)-3-(2,3,4-trifluorophenyl)-6-bicyclo[3.1.0]hex-2-enyl]-1,2,4-oxadiazol-5-yl]methyl]purin-6-one (PubChem CID 142421922) has the molecular formula C21H15F3N6O2 and a molecular weight of 440.39 g/mol. Its IUPAC name is 7-methyl-1-[[3-[(1R,5R,6S)-3-(2,3,4-trifluorophenyl)-6-bicyclo[3.1.0]hex-2-enyl]-1,2,4-oxadiazol-5-yl]methyl]purin-6-one.
| Compound Name | 7-methyl-1-[[3-[(1R,5R,6S)-3-(2,3,4-trifluorophenyl)-6-bicyclo[3.1.0]hex-2-enyl]-1,2,4-oxadiazol-5-yl]methyl]purin-6-one |
|---|---|
| PubChem CID | 142421922 |
| Molecular Formula | C21H15F3N6O2 |
| Molecular Weight | 440.39 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | 7-methyl-1-[[3-[(1R,5R,6S)-3-(2,3,4-trifluorophenyl)-6-bicyclo[3.1.0]hex-2-enyl]-1,2,4-oxadiazol-5-yl]methyl]purin-6-one |
| SMILES | Cn1cnc2ncn(Cc3nc([C@@H]4[C@H]5C=C(c6ccc(F)c(F)c6F)C[C@H]54)no3)c(=O)c21 |
| InChI | InChI=1S/C21H15F3N6O2/c1-29-7-25-20-18(29)21(31)30(8-26-20)6-14-27-19(28-32-14)15-11-4-9(5-12(11)15)10-2-3-13(22)17(24)16(10)23/h2-4,7-8,11-12,15H,5-6H2,1H3/t11-,12+,15+/m0/s1 |
| InChIKey | LDLLVRCAPFWYTL-YWPYICTPSA-N |
| XLogP | 2.80 |
| TPSA | 91.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.39 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|