C18H19ClFN7O2 — CID 142422042
6-amino-5-[amino(methyl)amino]-3-[[3-[3-(4-chlorophenyl)-3-fluorocyclobutyl]-1,2,4-oxadiazol-5-yl]methyl]pyrimidin-4-one (PubChem CID 142422042) has the molecular formula C18H19ClFN7O2 and a molecular weight of 419.85 g/mol. Its IUPAC name is 6-amino-5-[amino(methyl)amino]-3-[[3-[3-(4-chlorophenyl)-3-fluorocyclobutyl]-1,2,4-oxadiazol-5-yl]methyl]pyrimidin-4-one.
| Compound Name | 6-amino-5-[amino(methyl)amino]-3-[[3-[3-(4-chlorophenyl)-3-fluorocyclobutyl]-1,2,4-oxadiazol-5-yl]methyl]pyrimidin-4-one |
|---|---|
| PubChem CID | 142422042 |
| Molecular Formula | C18H19ClFN7O2 |
| Molecular Weight | 419.85 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | 6-amino-5-[amino(methyl)amino]-3-[[3-[3-(4-chlorophenyl)-3-fluorocyclobutyl]-1,2,4-oxadiazol-5-yl]methyl]pyrimidin-4-one |
| SMILES | CN(N)c1c(N)ncn(Cc2nc(C3CC(F)(c4ccc(Cl)cc4)C3)no2)c1=O |
| InChI | InChI=1S/C18H19ClFN7O2/c1-26(22)14-15(21)23-9-27(17(14)28)8-13-24-16(25-29-13)10-6-18(20,7-10)11-2-4-12(19)5-3-11/h2-5,9-10H,6-8,21-22H2,1H3 |
| InChIKey | OFBRKKUBYGIDMI-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 129.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.85 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|