About 5-[3-[(1S,5R)-3-azabicyclo[3.1.0]hexan-3-yl]phenyl]-1,3-oxazole
5-[3-[(1S,5R)-3-azabicyclo[3.1.0]hexan-3-yl]phenyl]-1,3-oxazole (PubChem CID 142422543) has the molecular formula C14H14N2O
and a molecular weight of 226.28 g/mol. Its IUPAC name is 5-[3-[(1S,5R)-3-azabicyclo[3.1.0]hexan-3-yl]phenyl]-1,3-oxazole.
Molecular Properties
| Compound Name | 5-[3-[(1S,5R)-3-azabicyclo[3.1.0]hexan-3-yl]phenyl]-1,3-oxazole |
| PubChem CID | 142422543 |
| Molecular Formula | C14H14N2O |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 5-[3-[(1S,5R)-3-azabicyclo[3.1.0]hexan-3-yl]phenyl]-1,3-oxazole |
| SMILES | c1cc(-c2cnco2)cc(N2C[C@H]3C[C@H]3C2)c1 |
| InChI | InChI=1S/C14H14N2O/c1-2-10(14-6-15-9-17-14)5-13(3-1)16-7-11-4-12(11)8-16/h1-3,5-6,9,11-12H,4,7-8H2/t11-,12+ |
| InChIKey | CCNHKWPDUBTCJE-TXEJJXNPSA-N |
| XLogP | 2.80 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[3-[(1S,5R)-3-azabicyclo[3.1.0]hexan-3-yl]phenyl]-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-[(1S,5R)-3-azabicyclo[3.1.0]hexan-3-yl]phenyl]-1,3-oxazole?
The IUPAC name of 5-[3-[(1S,5R)-3-azabicyclo[3.1.0]hexan-3-yl]phenyl]-1,3-oxazole (CID 142422543) is 5-[3-[(1S,5R)-3-azabicyclo[3.1.0]hexan-3-yl]phenyl]-1,3-oxazole.
What is the SMILES notation for 5-[3-[(1S,5R)-3-azabicyclo[3.1.0]hexan-3-yl]phenyl]-1,3-oxazole?
The canonical SMILES for 5-[3-[(1S,5R)-3-azabicyclo[3.1.0]hexan-3-yl]phenyl]-1,3-oxazole is c1cc(-c2cnco2)cc(N2C[C@H]3C[C@H]3C2)c1.
What is the InChIKey of 5-[3-[(1S,5R)-3-azabicyclo[3.1.0]hexan-3-yl]phenyl]-1,3-oxazole?
The InChIKey is CCNHKWPDUBTCJE-TXEJJXNPSA-N. The full InChI is InChI=1S/C14H14N2O/c1-2-10(14-6-15-9-17-14)5-13(3-1)16-7-11-4-12(11)8-16/h1-3,5-6,9,11-12H,4,7-8H2/t11-,12+.
What are the key properties of 5-[3-[(1S,5R)-3-azabicyclo[3.1.0]hexan-3-yl]phenyl]-1,3-oxazole?
5-[3-[(1S,5R)-3-azabicyclo[3.1.0]hexan-3-yl]phenyl]-1,3-oxazole has a molecular weight of 226.28 g/mol, XLogP of 2.80, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-[(1S,5R)-3-azabicyclo[3.1.0]hexan-3-yl]phenyl]-1,3-oxazole is sourced from PubChem (CID 142422543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).