About 4-[(1S,5R)-3-azabicyclo[3.1.0]hexan-3-yl]benzonitrile
4-[(1S,5R)-3-azabicyclo[3.1.0]hexan-3-yl]benzonitrile (PubChem CID 142422555) has the molecular formula C12H12N2
and a molecular weight of 184.24 g/mol. Its IUPAC name is 4-[(1S,5R)-3-azabicyclo[3.1.0]hexan-3-yl]benzonitrile.
Molecular Properties
| Compound Name | 4-[(1S,5R)-3-azabicyclo[3.1.0]hexan-3-yl]benzonitrile |
| PubChem CID | 142422555 |
| Molecular Formula | C12H12N2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 4-[(1S,5R)-3-azabicyclo[3.1.0]hexan-3-yl]benzonitrile |
| SMILES | N#Cc1ccc(N2C[C@H]3C[C@H]3C2)cc1 |
| InChI | InChI=1S/C12H12N2/c13-6-9-1-3-12(4-2-9)14-7-10-5-11(10)8-14/h1-4,10-11H,5,7-8H2/t10-,11+ |
| InChIKey | RVITYONVUUMZPD-PHIMTYICSA-N |
| XLogP | 2.01 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[(1S,5R)-3-azabicyclo[3.1.0]hexan-3-yl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1S,5R)-3-azabicyclo[3.1.0]hexan-3-yl]benzonitrile?
The IUPAC name of 4-[(1S,5R)-3-azabicyclo[3.1.0]hexan-3-yl]benzonitrile (CID 142422555) is 4-[(1S,5R)-3-azabicyclo[3.1.0]hexan-3-yl]benzonitrile.
What is the SMILES notation for 4-[(1S,5R)-3-azabicyclo[3.1.0]hexan-3-yl]benzonitrile?
The canonical SMILES for 4-[(1S,5R)-3-azabicyclo[3.1.0]hexan-3-yl]benzonitrile is N#Cc1ccc(N2C[C@H]3C[C@H]3C2)cc1.
What is the InChIKey of 4-[(1S,5R)-3-azabicyclo[3.1.0]hexan-3-yl]benzonitrile?
The InChIKey is RVITYONVUUMZPD-PHIMTYICSA-N. The full InChI is InChI=1S/C12H12N2/c13-6-9-1-3-12(4-2-9)14-7-10-5-11(10)8-14/h1-4,10-11H,5,7-8H2/t10-,11+.
What are the key properties of 4-[(1S,5R)-3-azabicyclo[3.1.0]hexan-3-yl]benzonitrile?
4-[(1S,5R)-3-azabicyclo[3.1.0]hexan-3-yl]benzonitrile has a molecular weight of 184.24 g/mol, XLogP of 2.01, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1S,5R)-3-azabicyclo[3.1.0]hexan-3-yl]benzonitrile is sourced from PubChem (CID 142422555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).