C14H23F2N — CID 142422851
1-[(3Z)-3,4-difluorohexa-1,3,5-trien-2-yl]-3,4-dimethylpyrrolidine;ethane (PubChem CID 142422851) has the molecular formula C14H23F2N and a molecular weight of 243.34 g/mol. Its IUPAC name is 1-[(3Z)-3,4-difluorohexa-1,3,5-trien-2-yl]-3,4-dimethylpyrrolidine;ethane.
| Compound Name | 1-[(3Z)-3,4-difluorohexa-1,3,5-trien-2-yl]-3,4-dimethylpyrrolidine;ethane |
|---|---|
| PubChem CID | 142422851 |
| Molecular Formula | C14H23F2N |
| Molecular Weight | 243.34 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | 1-[(3Z)-3,4-difluorohexa-1,3,5-trien-2-yl]-3,4-dimethylpyrrolidine;ethane |
| SMILES | C=C/C(F)=C(/F)C(=C)N1CC(C)C(C)C1.CC |
| InChI | InChI=1S/C12H17F2N.C2H6/c1-5-11(13)12(14)10(4)15-6-8(2)9(3)7-15;1-2/h5,8-9H,1,4,6-7H2,2-3H3;1-2H3/b12-11-; |
| InChIKey | OWARMFBZSNSEBK-AFEZEDKISA-N |
| XLogP | 4.45 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.34 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|