C15H12ClFN2O — CID 142422914
5-(chloromethyl)-3-[(1R,5R,6S)-3-(4-fluorophenyl)-6-bicyclo[3.1.0]hex-2-enyl]-1,2,4-oxadiazole (PubChem CID 142422914) has the molecular formula C15H12ClFN2O and a molecular weight of 290.73 g/mol. Its IUPAC name is 5-(chloromethyl)-3-[(1R,5R,6S)-3-(4-fluorophenyl)-6-bicyclo[3.1.0]hex-2-enyl]-1,2,4-oxadiazole.
| Compound Name | 5-(chloromethyl)-3-[(1R,5R,6S)-3-(4-fluorophenyl)-6-bicyclo[3.1.0]hex-2-enyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 142422914 |
| Molecular Formula | C15H12ClFN2O |
| Molecular Weight | 290.73 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | 5-(chloromethyl)-3-[(1R,5R,6S)-3-(4-fluorophenyl)-6-bicyclo[3.1.0]hex-2-enyl]-1,2,4-oxadiazole |
| SMILES | Fc1ccc(C2=C[C@H]3[C@@H](C2)[C@@H]3c2noc(CCl)n2)cc1 |
| InChI | InChI=1S/C15H12ClFN2O/c16-7-13-18-15(19-20-13)14-11-5-9(6-12(11)14)8-1-3-10(17)4-2-8/h1-5,11-12,14H,6-7H2/t11-,12+,14+/m0/s1 |
| InChIKey | FTNZYRSEZJSWCW-OUCADQQQSA-N |
| XLogP | 3.76 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.73 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|