About 3-(4-chlorophenyl)bicyclo[3.1.0]hex-2-ene;N'-hydroxymethanimidamide
3-(4-chlorophenyl)bicyclo[3.1.0]hex-2-ene;N'-hydroxymethanimidamide (PubChem CID 142423093) has the molecular formula C13H15ClN2O
and a molecular weight of 250.73 g/mol. Its IUPAC name is 3-(4-chlorophenyl)bicyclo[3.1.0]hex-2-ene;N'-hydroxymethanimidamide.
Molecular Properties
| Compound Name | 3-(4-chlorophenyl)bicyclo[3.1.0]hex-2-ene;N'-hydroxymethanimidamide |
| PubChem CID | 142423093 |
| Molecular Formula | C13H15ClN2O |
| Molecular Weight | 250.73 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 3-(4-chlorophenyl)bicyclo[3.1.0]hex-2-ene;N'-hydroxymethanimidamide |
| SMILES | Clc1ccc(C2=CC3CC3C2)cc1.N/C=N\O |
| InChI | InChI=1S/C12H11Cl.CH4N2O/c13-12-3-1-8(2-4-12)9-5-10-7-11(10)6-9;2-1-3-4/h1-5,10-11H,6-7H2;1,4H,(H2,2,3) |
| InChIKey | UBGKQHGUHAVYTR-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.73 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-chlorophenyl)bicyclo[3.1.0]hex-2-ene;N'-hydroxymethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-chlorophenyl)bicyclo[3.1.0]hex-2-ene;N'-hydroxymethanimidamide?
The IUPAC name of 3-(4-chlorophenyl)bicyclo[3.1.0]hex-2-ene;N'-hydroxymethanimidamide (CID 142423093) is 3-(4-chlorophenyl)bicyclo[3.1.0]hex-2-ene;N'-hydroxymethanimidamide.
What is the SMILES notation for 3-(4-chlorophenyl)bicyclo[3.1.0]hex-2-ene;N'-hydroxymethanimidamide?
The canonical SMILES for 3-(4-chlorophenyl)bicyclo[3.1.0]hex-2-ene;N'-hydroxymethanimidamide is Clc1ccc(C2=CC3CC3C2)cc1.N/C=N\O.
What is the InChIKey of 3-(4-chlorophenyl)bicyclo[3.1.0]hex-2-ene;N'-hydroxymethanimidamide?
The InChIKey is UBGKQHGUHAVYTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11Cl.CH4N2O/c13-12-3-1-8(2-4-12)9-5-10-7-11(10)6-9;2-1-3-4/h1-5,10-11H,6-7H2;1,4H,(H2,2,3).
What are the key properties of 3-(4-chlorophenyl)bicyclo[3.1.0]hex-2-ene;N'-hydroxymethanimidamide?
3-(4-chlorophenyl)bicyclo[3.1.0]hex-2-ene;N'-hydroxymethanimidamide has a molecular weight of 250.73 g/mol, XLogP of 3.13, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-chlorophenyl)bicyclo[3.1.0]hex-2-ene;N'-hydroxymethanimidamide is sourced from PubChem (CID 142423093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).