C18H21F2N3O3 — CID 142423688
(2E,3E,5Z)-5-[(3,3-difluorooxan-4-yl)amino]-2-ethylidene-6-nitro-4-prop-1-en-2-ylocta-3,5,7-trienenitrile (PubChem CID 142423688) has the molecular formula C18H21F2N3O3 and a molecular weight of 365.38 g/mol. Its IUPAC name is (2E,3E,5Z)-5-[(3,3-difluorooxan-4-yl)amino]-2-ethylidene-6-nitro-4-prop-1-en-2-ylocta-3,5,7-trienenitrile.
| Compound Name | (2E,3E,5Z)-5-[(3,3-difluorooxan-4-yl)amino]-2-ethylidene-6-nitro-4-prop-1-en-2-ylocta-3,5,7-trienenitrile |
|---|---|
| PubChem CID | 142423688 |
| Molecular Formula | C18H21F2N3O3 |
| Molecular Weight | 365.38 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | (2E,3E,5Z)-5-[(3,3-difluorooxan-4-yl)amino]-2-ethylidene-6-nitro-4-prop-1-en-2-ylocta-3,5,7-trienenitrile |
| SMILES | C=C/C(=C(NC1CCOCC1(F)F)\C(=C\C(C#N)=C/C)C(=C)C)[N+](=O)[O-] |
| InChI | InChI=1S/C18H21F2N3O3/c1-5-13(10-21)9-14(12(3)4)17(15(6-2)23(24)25)22-16-7-8-26-11-18(16,19)20/h5-6,9,16,22H,2-3,7-8,11H2,1,4H3/b13-5+,14-9+,17-15- |
| InChIKey | YJBDUOQEUCCDTH-KLWCJAJQSA-N |
| XLogP | 3.65 |
| TPSA | 88.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.38 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|