About 5-benzylsulfanyl-2,3-dihydro-1H-inden-2-ol
5-benzylsulfanyl-2,3-dihydro-1H-inden-2-ol (PubChem CID 142423987) has the molecular formula C16H16OS
and a molecular weight of 256.37 g/mol. Its IUPAC name is 5-benzylsulfanyl-2,3-dihydro-1H-inden-2-ol.
Molecular Properties
| Compound Name | 5-benzylsulfanyl-2,3-dihydro-1H-inden-2-ol |
| PubChem CID | 142423987 |
| Molecular Formula | C16H16OS |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 5-benzylsulfanyl-2,3-dihydro-1H-inden-2-ol |
| SMILES | OC1Cc2ccc(SCc3ccccc3)cc2C1 |
| InChI | InChI=1S/C16H16OS/c17-15-8-13-6-7-16(10-14(13)9-15)18-11-12-4-2-1-3-5-12/h1-7,10,15,17H,8-9,11H2 |
| InChIKey | PKCHNRVTDQDHKV-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-benzylsulfanyl-2,3-dihydro-1H-inden-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-benzylsulfanyl-2,3-dihydro-1H-inden-2-ol?
The IUPAC name of 5-benzylsulfanyl-2,3-dihydro-1H-inden-2-ol (CID 142423987) is 5-benzylsulfanyl-2,3-dihydro-1H-inden-2-ol.
What is the SMILES notation for 5-benzylsulfanyl-2,3-dihydro-1H-inden-2-ol?
The canonical SMILES for 5-benzylsulfanyl-2,3-dihydro-1H-inden-2-ol is OC1Cc2ccc(SCc3ccccc3)cc2C1.
What is the InChIKey of 5-benzylsulfanyl-2,3-dihydro-1H-inden-2-ol?
The InChIKey is PKCHNRVTDQDHKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16OS/c17-15-8-13-6-7-16(10-14(13)9-15)18-11-12-4-2-1-3-5-12/h1-7,10,15,17H,8-9,11H2.
What are the key properties of 5-benzylsulfanyl-2,3-dihydro-1H-inden-2-ol?
5-benzylsulfanyl-2,3-dihydro-1H-inden-2-ol has a molecular weight of 256.37 g/mol, XLogP of 3.44, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-benzylsulfanyl-2,3-dihydro-1H-inden-2-ol is sourced from PubChem (CID 142423987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).