C25H13F8NO2S — CID 142424070
2-[2-[5-(2,3,4,5,6-pentafluorophenoxy)sulfanyl-2,3-dihydro-1H-inden-1-yl]-5-(trifluoromethyl)phenyl]-1,3-oxazole (PubChem CID 142424070) has the molecular formula C25H13F8NO2S and a molecular weight of 543.44 g/mol. Its IUPAC name is 2-[2-[5-(2,3,4,5,6-pentafluorophenoxy)sulfanyl-2,3-dihydro-1H-inden-1-yl]-5-(trifluoromethyl)phenyl]-1,3-oxazole.
| Compound Name | 2-[2-[5-(2,3,4,5,6-pentafluorophenoxy)sulfanyl-2,3-dihydro-1H-inden-1-yl]-5-(trifluoromethyl)phenyl]-1,3-oxazole |
|---|---|
| PubChem CID | 142424070 |
| Molecular Formula | C25H13F8NO2S |
| Molecular Weight | 543.44 g/mol |
| Exact Mass | 543.05 |
| IUPAC Name | 2-[2-[5-(2,3,4,5,6-pentafluorophenoxy)sulfanyl-2,3-dihydro-1H-inden-1-yl]-5-(trifluoromethyl)phenyl]-1,3-oxazole |
| SMILES | Fc1c(F)c(F)c(OSc2ccc3c(c2)CCC3c2ccc(C(F)(F)F)cc2-c2ncco2)c(F)c1F |
| InChI | InChI=1S/C25H13F8NO2S/c26-18-19(27)21(29)23(22(30)20(18)28)36-37-13-3-6-14-11(9-13)1-4-15(14)16-5-2-12(25(31,32)33)10-17(16)24-34-7-8-35-24/h2-3,5-10,15H,1,4H2 |
| InChIKey | FFDLWRWBQWLCKR-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.44 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|