C40H38O4 — CID 142424793
ethane;4-(10-naphthalen-1-yl-3,4-dihydroanthracen-9-yl)-6,7-dihydrodibenzofuran-1,2,3-triol (PubChem CID 142424793) has the molecular formula C40H38O4 and a molecular weight of 582.74 g/mol. Its IUPAC name is ethane;4-(10-naphthalen-1-yl-3,4-dihydroanthracen-9-yl)-6,7-dihydrodibenzofuran-1,2,3-triol.
| Compound Name | ethane;4-(10-naphthalen-1-yl-3,4-dihydroanthracen-9-yl)-6,7-dihydrodibenzofuran-1,2,3-triol |
|---|---|
| PubChem CID | 142424793 |
| Molecular Formula | C40H38O4 |
| Molecular Weight | 582.74 g/mol |
| Exact Mass | 582.28 |
| IUPAC Name | ethane;4-(10-naphthalen-1-yl-3,4-dihydroanthracen-9-yl)-6,7-dihydrodibenzofuran-1,2,3-triol |
| SMILES | CC.CC.Oc1c(O)c(O)c2c3c(oc2c1-c1c2c(c(-c4cccc5ccccc45)c4ccccc14)CCC=C2)CCC=C3 |
| InChI | InChI=1S/C36H26O4.2C2H6/c37-33-31-27-17-7-8-19-28(27)40-36(31)32(34(38)35(33)39)30-25-15-5-3-13-23(25)29(24-14-4-6-16-26(24)30)22-18-9-11-20-10-1-2-12-21(20)22;2*1-2/h1-3,5-7,9-13,15-18,37-39H,4,8,14,19H2;2*1-2H3 |
| InChIKey | ATBKMJPGKBEXRQ-UHFFFAOYSA-N |
| XLogP | 11.16 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.74 |
| LogP ≤ 5 | 11.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|