C39H26ClN3 — CID 142425295
2-(4-chlorophenyl)-4-phenyl-6-[3-[3-(3-phenylphenyl)phenyl]phenyl]-1,3,5-triazine (PubChem CID 142425295) has the molecular formula C39H26ClN3 and a molecular weight of 572.11 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-4-phenyl-6-[3-[3-(3-phenylphenyl)phenyl]phenyl]-1,3,5-triazine.
| Compound Name | 2-(4-chlorophenyl)-4-phenyl-6-[3-[3-(3-phenylphenyl)phenyl]phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 142425295 |
| Molecular Formula | C39H26ClN3 |
| Molecular Weight | 572.11 g/mol |
| Exact Mass | 571.18 |
| IUPAC Name | 2-(4-chlorophenyl)-4-phenyl-6-[3-[3-(3-phenylphenyl)phenyl]phenyl]-1,3,5-triazine |
| SMILES | Clc1ccc(-c2nc(-c3ccccc3)nc(-c3cccc(-c4cccc(-c5cccc(-c6ccccc6)c5)c4)c3)n2)cc1 |
| InChI | InChI=1S/C39H26ClN3/c40-36-22-20-29(21-23-36)38-41-37(28-12-5-2-6-13-28)42-39(43-38)35-19-9-18-34(26-35)33-17-8-16-32(25-33)31-15-7-14-30(24-31)27-10-3-1-4-11-27/h1-26H |
| InChIKey | BIOIGTUDXDKCBS-UHFFFAOYSA-N |
| XLogP | 10.53 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.11 |
| LogP ≤ 5 | 10.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |