C24H20F2N4O8 — CID 142425404
2-(2,6-difluorophenyl)-7,7-dihydroxy-4-[4-(2,2,5,5-tetrahydroxypyrrolidine-1-carbonyl)anilino]-6H-pyrrolo[3,4-b]pyridin-5-one (PubChem CID 142425404) has the molecular formula C24H20F2N4O8 and a molecular weight of 530.44 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-7,7-dihydroxy-4-[4-(2,2,5,5-tetrahydroxypyrrolidine-1-carbonyl)anilino]-6H-pyrrolo[3,4-b]pyridin-5-one.
| Compound Name | 2-(2,6-difluorophenyl)-7,7-dihydroxy-4-[4-(2,2,5,5-tetrahydroxypyrrolidine-1-carbonyl)anilino]-6H-pyrrolo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 142425404 |
| Molecular Formula | C24H20F2N4O8 |
| Molecular Weight | 530.44 g/mol |
| Exact Mass | 530.12 |
| IUPAC Name | 2-(2,6-difluorophenyl)-7,7-dihydroxy-4-[4-(2,2,5,5-tetrahydroxypyrrolidine-1-carbonyl)anilino]-6H-pyrrolo[3,4-b]pyridin-5-one |
| SMILES | O=C1NC(O)(O)c2nc(-c3c(F)cccc3F)cc(Nc3ccc(C(=O)N4C(O)(O)CCC4(O)O)cc3)c21 |
| InChI | InChI=1S/C24H20F2N4O8/c25-13-2-1-3-14(26)17(13)15-10-16(18-19(28-15)24(37,38)29-20(18)31)27-12-6-4-11(5-7-12)21(32)30-22(33,34)8-9-23(30,35)36/h1-7,10,33-38H,8-9H2,(H,27,28)(H,29,31) |
| InChIKey | BZPYJMLHMSMEFF-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 195.71 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.44 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|