About 1-[2-(4-fluorocyclohexa-1,3-dien-1-yl)cyclohexa-1,5-dien-1-yl]cyclopropan-1-amine
1-[2-(4-fluorocyclohexa-1,3-dien-1-yl)cyclohexa-1,5-dien-1-yl]cyclopropan-1-amine (PubChem CID 142425720) has the molecular formula C15H18FN
and a molecular weight of 231.31 g/mol. Its IUPAC name is 1-[2-(4-fluorocyclohexa-1,3-dien-1-yl)cyclohexa-1,5-dien-1-yl]cyclopropan-1-amine.
Molecular Properties
| Compound Name | 1-[2-(4-fluorocyclohexa-1,3-dien-1-yl)cyclohexa-1,5-dien-1-yl]cyclopropan-1-amine |
| PubChem CID | 142425720 |
| Molecular Formula | C15H18FN |
| Molecular Weight | 231.31 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | 1-[2-(4-fluorocyclohexa-1,3-dien-1-yl)cyclohexa-1,5-dien-1-yl]cyclopropan-1-amine |
| SMILES | NC1(C2=C(C3=CC=C(F)CC3)CCC=C2)CC1 |
| InChI | InChI=1S/C15H18FN/c16-12-7-5-11(6-8-12)13-3-1-2-4-14(13)15(17)9-10-15/h2,4-5,7H,1,3,6,8-10,17H2 |
| InChIKey | OZOJIEGODIASFC-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.31 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[2-(4-fluorocyclohexa-1,3-dien-1-yl)cyclohexa-1,5-dien-1-yl]cyclopropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(4-fluorocyclohexa-1,3-dien-1-yl)cyclohexa-1,5-dien-1-yl]cyclopropan-1-amine?
The IUPAC name of 1-[2-(4-fluorocyclohexa-1,3-dien-1-yl)cyclohexa-1,5-dien-1-yl]cyclopropan-1-amine (CID 142425720) is 1-[2-(4-fluorocyclohexa-1,3-dien-1-yl)cyclohexa-1,5-dien-1-yl]cyclopropan-1-amine.
What is the SMILES notation for 1-[2-(4-fluorocyclohexa-1,3-dien-1-yl)cyclohexa-1,5-dien-1-yl]cyclopropan-1-amine?
The canonical SMILES for 1-[2-(4-fluorocyclohexa-1,3-dien-1-yl)cyclohexa-1,5-dien-1-yl]cyclopropan-1-amine is NC1(C2=C(C3=CC=C(F)CC3)CCC=C2)CC1.
What is the InChIKey of 1-[2-(4-fluorocyclohexa-1,3-dien-1-yl)cyclohexa-1,5-dien-1-yl]cyclopropan-1-amine?
The InChIKey is OZOJIEGODIASFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18FN/c16-12-7-5-11(6-8-12)13-3-1-2-4-14(13)15(17)9-10-15/h2,4-5,7H,1,3,6,8-10,17H2.
What are the key properties of 1-[2-(4-fluorocyclohexa-1,3-dien-1-yl)cyclohexa-1,5-dien-1-yl]cyclopropan-1-amine?
1-[2-(4-fluorocyclohexa-1,3-dien-1-yl)cyclohexa-1,5-dien-1-yl]cyclopropan-1-amine has a molecular weight of 231.31 g/mol, XLogP of 3.70, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(4-fluorocyclohexa-1,3-dien-1-yl)cyclohexa-1,5-dien-1-yl]cyclopropan-1-amine is sourced from PubChem (CID 142425720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).