C9H23N3 — CID 142425880
1-N,6-dimethylheptane-1,2,5-triamine (PubChem CID 142425880) has the molecular formula C9H23N3 and a molecular weight of 173.30 g/mol. Its IUPAC name is 1-N,6-dimethylheptane-1,2,5-triamine.
| Compound Name | 1-N,6-dimethylheptane-1,2,5-triamine |
|---|---|
| PubChem CID | 142425880 |
| Molecular Formula | C9H23N3 |
| Molecular Weight | 173.30 g/mol |
| Exact Mass | 173.19 |
| IUPAC Name | 1-N,6-dimethylheptane-1,2,5-triamine |
| SMILES | CNCC(N)CCC(N)C(C)C |
| InChI | InChI=1S/C9H23N3/c1-7(2)9(11)5-4-8(10)6-12-3/h7-9,12H,4-6,10-11H2,1-3H3 |
| InChIKey | IVMJISIPJHGELX-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.30 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |