About ethane;1-methyl-2,5-dihydropyrrol-3-amine
ethane;1-methyl-2,5-dihydropyrrol-3-amine (PubChem CID 142426419) has the molecular formula C7H16N2
and a molecular weight of 128.22 g/mol. Its IUPAC name is ethane;1-methyl-2,5-dihydropyrrol-3-amine.
Molecular Properties
| Compound Name | ethane;1-methyl-2,5-dihydropyrrol-3-amine |
| PubChem CID | 142426419 |
| Molecular Formula | C7H16N2 |
| Molecular Weight | 128.22 g/mol |
| Exact Mass | 128.13 |
| IUPAC Name | ethane;1-methyl-2,5-dihydropyrrol-3-amine |
| SMILES | CC.CN1CC=C(N)C1 |
| InChI | InChI=1S/C5H10N2.C2H6/c1-7-3-2-5(6)4-7;1-2/h2H,3-4,6H2,1H3;1-2H3 |
| InChIKey | MPOJITSZQRCILS-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.22 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;1-methyl-2,5-dihydropyrrol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methyl-2,5-dihydropyrrol-3-amine?
The IUPAC name of ethane;1-methyl-2,5-dihydropyrrol-3-amine (CID 142426419) is ethane;1-methyl-2,5-dihydropyrrol-3-amine.
What is the SMILES notation for ethane;1-methyl-2,5-dihydropyrrol-3-amine?
The canonical SMILES for ethane;1-methyl-2,5-dihydropyrrol-3-amine is CC.CN1CC=C(N)C1.
What is the InChIKey of ethane;1-methyl-2,5-dihydropyrrol-3-amine?
The InChIKey is MPOJITSZQRCILS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2.C2H6/c1-7-3-2-5(6)4-7;1-2/h2H,3-4,6H2,1H3;1-2H3.
What are the key properties of ethane;1-methyl-2,5-dihydropyrrol-3-amine?
ethane;1-methyl-2,5-dihydropyrrol-3-amine has a molecular weight of 128.22 g/mol, XLogP of 0.80, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methyl-2,5-dihydropyrrol-3-amine is sourced from PubChem (CID 142426419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).