About 6-amino-1-methyl-5H-pyrazolo[5,4-d]pyrimidin-4-one;ethane
6-amino-1-methyl-5H-pyrazolo[5,4-d]pyrimidin-4-one;ethane (PubChem CID 142426508) has the molecular formula C10H19N5O
and a molecular weight of 225.30 g/mol. Its IUPAC name is 6-amino-1-methyl-5H-pyrazolo[5,4-d]pyrimidin-4-one;ethane.
Molecular Properties
| Compound Name | 6-amino-1-methyl-5H-pyrazolo[5,4-d]pyrimidin-4-one;ethane |
| PubChem CID | 142426508 |
| Molecular Formula | C10H19N5O |
| Molecular Weight | 225.30 g/mol |
| Exact Mass | 225.16 |
| IUPAC Name | 6-amino-1-methyl-5H-pyrazolo[5,4-d]pyrimidin-4-one;ethane |
| SMILES | CC.CC.Cn1ncc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C6H7N5O.2C2H6/c1-11-4-3(2-8-11)5(12)10-6(7)9-4;2*1-2/h2H,1H3,(H3,7,9,10,12);2*1-2H3 |
| InChIKey | HBTKLJWXVKVACC-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 89.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.30 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-amino-1-methyl-5H-pyrazolo[5,4-d]pyrimidin-4-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-1-methyl-5H-pyrazolo[5,4-d]pyrimidin-4-one;ethane?
The IUPAC name of 6-amino-1-methyl-5H-pyrazolo[5,4-d]pyrimidin-4-one;ethane (CID 142426508) is 6-amino-1-methyl-5H-pyrazolo[5,4-d]pyrimidin-4-one;ethane.
What is the SMILES notation for 6-amino-1-methyl-5H-pyrazolo[5,4-d]pyrimidin-4-one;ethane?
The canonical SMILES for 6-amino-1-methyl-5H-pyrazolo[5,4-d]pyrimidin-4-one;ethane is CC.CC.Cn1ncc2c(=O)[nH]c(N)nc21.
What is the InChIKey of 6-amino-1-methyl-5H-pyrazolo[5,4-d]pyrimidin-4-one;ethane?
The InChIKey is HBTKLJWXVKVACC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N5O.2C2H6/c1-11-4-3(2-8-11)5(12)10-6(7)9-4;2*1-2/h2H,1H3,(H3,7,9,10,12);2*1-2H3.
What are the key properties of 6-amino-1-methyl-5H-pyrazolo[5,4-d]pyrimidin-4-one;ethane?
6-amino-1-methyl-5H-pyrazolo[5,4-d]pyrimidin-4-one;ethane has a molecular weight of 225.30 g/mol, XLogP of 1.29, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-1-methyl-5H-pyrazolo[5,4-d]pyrimidin-4-one;ethane is sourced from PubChem (CID 142426508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).