About 6-amino-2-[3-(2,2-dimethylpropoxy)-3-methylbutoxy]-2-methylhexan-3-one
6-amino-2-[3-(2,2-dimethylpropoxy)-3-methylbutoxy]-2-methylhexan-3-one (PubChem CID 142426761) has the molecular formula C17H35NO3
and a molecular weight of 301.47 g/mol. Its IUPAC name is 6-amino-2-[3-(2,2-dimethylpropoxy)-3-methylbutoxy]-2-methylhexan-3-one.
Molecular Properties
| Compound Name | 6-amino-2-[3-(2,2-dimethylpropoxy)-3-methylbutoxy]-2-methylhexan-3-one |
| PubChem CID | 142426761 |
| Molecular Formula | C17H35NO3 |
| Molecular Weight | 301.47 g/mol |
| Exact Mass | 301.26 |
| IUPAC Name | 6-amino-2-[3-(2,2-dimethylpropoxy)-3-methylbutoxy]-2-methylhexan-3-one |
| SMILES | CC(C)(C)COC(C)(C)CCOC(C)(C)C(=O)CCCN |
| InChI | InChI=1S/C17H35NO3/c1-15(2,3)13-21-16(4,5)10-12-20-17(6,7)14(19)9-8-11-18/h8-13,18H2,1-7H3 |
| InChIKey | SWGSBUASMTWMDV-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.47 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-amino-2-[3-(2,2-dimethylpropoxy)-3-methylbutoxy]-2-methylhexan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-2-[3-(2,2-dimethylpropoxy)-3-methylbutoxy]-2-methylhexan-3-one?
The IUPAC name of 6-amino-2-[3-(2,2-dimethylpropoxy)-3-methylbutoxy]-2-methylhexan-3-one (CID 142426761) is 6-amino-2-[3-(2,2-dimethylpropoxy)-3-methylbutoxy]-2-methylhexan-3-one.
What is the SMILES notation for 6-amino-2-[3-(2,2-dimethylpropoxy)-3-methylbutoxy]-2-methylhexan-3-one?
The canonical SMILES for 6-amino-2-[3-(2,2-dimethylpropoxy)-3-methylbutoxy]-2-methylhexan-3-one is CC(C)(C)COC(C)(C)CCOC(C)(C)C(=O)CCCN.
What is the InChIKey of 6-amino-2-[3-(2,2-dimethylpropoxy)-3-methylbutoxy]-2-methylhexan-3-one?
The InChIKey is SWGSBUASMTWMDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H35NO3/c1-15(2,3)13-21-16(4,5)10-12-20-17(6,7)14(19)9-8-11-18/h8-13,18H2,1-7H3.
What are the key properties of 6-amino-2-[3-(2,2-dimethylpropoxy)-3-methylbutoxy]-2-methylhexan-3-one?
6-amino-2-[3-(2,2-dimethylpropoxy)-3-methylbutoxy]-2-methylhexan-3-one has a molecular weight of 301.47 g/mol, XLogP of 3.32, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-2-[3-(2,2-dimethylpropoxy)-3-methylbutoxy]-2-methylhexan-3-one is sourced from PubChem (CID 142426761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).