C17H12ClFN6 — CID 142426973
8-(2-chloro-6-methyl-4-pyridinyl)-7-(4-fluorophenyl)-[1,2,4]triazolo[4,3-c]pyrimidin-5-amine (PubChem CID 142426973) has the molecular formula C17H12ClFN6 and a molecular weight of 354.78 g/mol. Its IUPAC name is 8-(2-chloro-6-methyl-4-pyridinyl)-7-(4-fluorophenyl)-[1,2,4]triazolo[4,3-c]pyrimidin-5-amine.
| Compound Name | 8-(2-chloro-6-methyl-4-pyridinyl)-7-(4-fluorophenyl)-[1,2,4]triazolo[4,3-c]pyrimidin-5-amine |
|---|---|
| PubChem CID | 142426973 |
| Molecular Formula | C17H12ClFN6 |
| Molecular Weight | 354.78 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | 8-(2-chloro-6-methyl-4-pyridinyl)-7-(4-fluorophenyl)-[1,2,4]triazolo[4,3-c]pyrimidin-5-amine |
| SMILES | Cc1cc(-c2c(-c3ccc(F)cc3)nc(N)n3cnnc23)cc(Cl)n1 |
| InChI | InChI=1S/C17H12ClFN6/c1-9-6-11(7-13(18)22-9)14-15(10-2-4-12(19)5-3-10)23-17(20)25-8-21-24-16(14)25/h2-8H,1H3,(H2,20,23) |
| InChIKey | XFHWLSWRPMZDRV-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.78 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|