C17H11ClF2N6 — CID 142427014
8-(2-chloro-6-methyl-4-pyridinyl)-7-(2,4-difluorophenyl)-[1,2,4]triazolo[4,3-c]pyrimidin-5-amine (PubChem CID 142427014) has the molecular formula C17H11ClF2N6 and a molecular weight of 372.77 g/mol. Its IUPAC name is 8-(2-chloro-6-methyl-4-pyridinyl)-7-(2,4-difluorophenyl)-[1,2,4]triazolo[4,3-c]pyrimidin-5-amine.
| Compound Name | 8-(2-chloro-6-methyl-4-pyridinyl)-7-(2,4-difluorophenyl)-[1,2,4]triazolo[4,3-c]pyrimidin-5-amine |
|---|---|
| PubChem CID | 142427014 |
| Molecular Formula | C17H11ClF2N6 |
| Molecular Weight | 372.77 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | 8-(2-chloro-6-methyl-4-pyridinyl)-7-(2,4-difluorophenyl)-[1,2,4]triazolo[4,3-c]pyrimidin-5-amine |
| SMILES | Cc1cc(-c2c(-c3ccc(F)cc3F)nc(N)n3cnnc23)cc(Cl)n1 |
| InChI | InChI=1S/C17H11ClF2N6/c1-8-4-9(5-13(18)23-8)14-15(11-3-2-10(19)6-12(11)20)24-17(21)26-7-22-25-16(14)26/h2-7H,1H3,(H2,21,24) |
| InChIKey | CBSGQIKVKYAHDM-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.77 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|