C22H40 — CID 142427618
1-methyl-4-(3,6,7,10-tetramethylundec-1-ynyl)cyclohexane (PubChem CID 142427618) has the molecular formula C22H40 and a molecular weight of 304.56 g/mol. Its IUPAC name is 1-methyl-4-(3,6,7,10-tetramethylundec-1-ynyl)cyclohexane.
| Compound Name | 1-methyl-4-(3,6,7,10-tetramethylundec-1-ynyl)cyclohexane |
|---|---|
| PubChem CID | 142427618 |
| Molecular Formula | C22H40 |
| Molecular Weight | 304.56 g/mol |
| Exact Mass | 304.31 |
| IUPAC Name | 1-methyl-4-(3,6,7,10-tetramethylundec-1-ynyl)cyclohexane |
| SMILES | CC(C)CCC(C)C(C)CCC(C)C#CC1CCC(C)CC1 |
| InChI | InChI=1S/C22H40/c1-17(2)7-12-20(5)21(6)13-8-18(3)9-14-22-15-10-19(4)11-16-22/h17-22H,7-8,10-13,15-16H2,1-6H3 |
| InChIKey | DJCIGIKWECRLPX-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.56 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|