About 5-chloro-1-methylindole-2-carboxamide;(2S)-2-(4-ethylphenyl)sulfonylpropanoic acid
5-chloro-1-methylindole-2-carboxamide;(2S)-2-(4-ethylphenyl)sulfonylpropanoic acid (PubChem CID 142427762) has the molecular formula C21H23ClN2O5S
and a molecular weight of 450.94 g/mol. Its IUPAC name is 5-chloro-1-methylindole-2-carboxamide;(2S)-2-(4-ethylphenyl)sulfonylpropanoic acid.
Molecular Properties
| Compound Name | 5-chloro-1-methylindole-2-carboxamide;(2S)-2-(4-ethylphenyl)sulfonylpropanoic acid |
| PubChem CID | 142427762 |
| Molecular Formula | C21H23ClN2O5S |
| Molecular Weight | 450.94 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | 5-chloro-1-methylindole-2-carboxamide;(2S)-2-(4-ethylphenyl)sulfonylpropanoic acid |
| SMILES | CCc1ccc(S(=O)(=O)[C@@H](C)C(=O)O)cc1.Cn1c(C(N)=O)cc2cc(Cl)ccc21 |
| InChI | InChI=1S/C11H14O4S.C10H9ClN2O/c1-3-9-4-6-10(7-5-9)16(14,15)8(2)11(12)13;1-13-8-3-2-7(11)4-6(8)5-9(13)10(12)14/h4-8H,3H2,1-2H3,(H,12,13);2-5H,1H3,(H2,12,14)/t8-;/m0./s1 |
| InChIKey | SJOLFGRUNQMWRM-QRPNPIFTSA-N |
| XLogP | 3.43 |
| TPSA | 119.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 450.94 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-chloro-1-methylindole-2-carboxamide;(2S)-2-(4-ethylphenyl)sulfonylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-1-methylindole-2-carboxamide;(2S)-2-(4-ethylphenyl)sulfonylpropanoic acid?
The IUPAC name of 5-chloro-1-methylindole-2-carboxamide;(2S)-2-(4-ethylphenyl)sulfonylpropanoic acid (CID 142427762) is 5-chloro-1-methylindole-2-carboxamide;(2S)-2-(4-ethylphenyl)sulfonylpropanoic acid.
What is the SMILES notation for 5-chloro-1-methylindole-2-carboxamide;(2S)-2-(4-ethylphenyl)sulfonylpropanoic acid?
The canonical SMILES for 5-chloro-1-methylindole-2-carboxamide;(2S)-2-(4-ethylphenyl)sulfonylpropanoic acid is CCc1ccc(S(=O)(=O)[C@@H](C)C(=O)O)cc1.Cn1c(C(N)=O)cc2cc(Cl)ccc21.
What is the InChIKey of 5-chloro-1-methylindole-2-carboxamide;(2S)-2-(4-ethylphenyl)sulfonylpropanoic acid?
The InChIKey is SJOLFGRUNQMWRM-QRPNPIFTSA-N. The full InChI is InChI=1S/C11H14O4S.C10H9ClN2O/c1-3-9-4-6-10(7-5-9)16(14,15)8(2)11(12)13;1-13-8-3-2-7(11)4-6(8)5-9(13)10(12)14/h4-8H,3H2,1-2H3,(H,12,13);2-5H,1H3,(H2,12,14)/t8-;/m0./s1.
What are the key properties of 5-chloro-1-methylindole-2-carboxamide;(2S)-2-(4-ethylphenyl)sulfonylpropanoic acid?
5-chloro-1-methylindole-2-carboxamide;(2S)-2-(4-ethylphenyl)sulfonylpropanoic acid has a molecular weight of 450.94 g/mol, XLogP of 3.43, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-1-methylindole-2-carboxamide;(2S)-2-(4-ethylphenyl)sulfonylpropanoic acid is sourced from PubChem (CID 142427762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).