C25H27ClN2O7S — CID 142427830
2-acetyloxyethyl 2-[4-[(1R)-1-[(4-chloro-1,6-dimethylindole-2-carbonyl)amino]ethyl]phenyl]sulfonylacetate (PubChem CID 142427830) has the molecular formula C25H27ClN2O7S and a molecular weight of 535.02 g/mol. Its IUPAC name is 2-acetyloxyethyl 2-[4-[(1R)-1-[(4-chloro-1,6-dimethylindole-2-carbonyl)amino]ethyl]phenyl]sulfonylacetate.
| Compound Name | 2-acetyloxyethyl 2-[4-[(1R)-1-[(4-chloro-1,6-dimethylindole-2-carbonyl)amino]ethyl]phenyl]sulfonylacetate |
|---|---|
| PubChem CID | 142427830 |
| Molecular Formula | C25H27ClN2O7S |
| Molecular Weight | 535.02 g/mol |
| Exact Mass | 534.12 |
| IUPAC Name | 2-acetyloxyethyl 2-[4-[(1R)-1-[(4-chloro-1,6-dimethylindole-2-carbonyl)amino]ethyl]phenyl]sulfonylacetate |
| SMILES | CC(=O)OCCOC(=O)CS(=O)(=O)c1ccc([C@@H](C)NC(=O)c2cc3c(Cl)cc(C)cc3n2C)cc1 |
| InChI | InChI=1S/C25H27ClN2O7S/c1-15-11-21(26)20-13-23(28(4)22(20)12-15)25(31)27-16(2)18-5-7-19(8-6-18)36(32,33)14-24(30)35-10-9-34-17(3)29/h5-8,11-13,16H,9-10,14H2,1-4H3,(H,27,31)/t16-/m1/s1 |
| InChIKey | GRWPFHWDFNZJSU-MRXNPFEDSA-N |
| XLogP | 3.51 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.02 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|