C18H18F2N4O — CID 142427985
6-amino-3-(3-ethyl-2-fluoro-1H-pyrrolo[2,3-b]pyridin-5-yl)-2-fluoro-N,N-dimethylbenzamide (PubChem CID 142427985) has the molecular formula C18H18F2N4O and a molecular weight of 344.37 g/mol. Its IUPAC name is 6-amino-3-(3-ethyl-2-fluoro-1H-pyrrolo[2,3-b]pyridin-5-yl)-2-fluoro-N,N-dimethylbenzamide.
| Compound Name | 6-amino-3-(3-ethyl-2-fluoro-1H-pyrrolo[2,3-b]pyridin-5-yl)-2-fluoro-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 142427985 |
| Molecular Formula | C18H18F2N4O |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 6-amino-3-(3-ethyl-2-fluoro-1H-pyrrolo[2,3-b]pyridin-5-yl)-2-fluoro-N,N-dimethylbenzamide |
| SMILES | CCc1c(F)[nH]c2ncc(-c3ccc(N)c(C(=O)N(C)C)c3F)cc12 |
| InChI | InChI=1S/C18H18F2N4O/c1-4-10-12-7-9(8-22-17(12)23-16(10)20)11-5-6-13(21)14(15(11)19)18(25)24(2)3/h5-8H,4,21H2,1-3H3,(H,22,23) |
| InChIKey | RNLCQNXNNPQPQP-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|