C17H30N2O4 — CID 142428061
3-(2,3-dihydroxypropylamino)-4-(2,4,4,5-tetramethylhexan-2-ylamino)cyclobut-3-ene-1,2-dione (PubChem CID 142428061) has the molecular formula C17H30N2O4 and a molecular weight of 326.44 g/mol. Its IUPAC name is 3-(2,3-dihydroxypropylamino)-4-(2,4,4,5-tetramethylhexan-2-ylamino)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-(2,3-dihydroxypropylamino)-4-(2,4,4,5-tetramethylhexan-2-ylamino)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 142428061 |
| Molecular Formula | C17H30N2O4 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | 3-(2,3-dihydroxypropylamino)-4-(2,4,4,5-tetramethylhexan-2-ylamino)cyclobut-3-ene-1,2-dione |
| SMILES | CC(C)C(C)(C)CC(C)(C)Nc1c(NCC(O)CO)c(=O)c1=O |
| InChI | InChI=1S/C17H30N2O4/c1-10(2)16(3,4)9-17(5,6)19-13-12(14(22)15(13)23)18-7-11(21)8-20/h10-11,18-21H,7-9H2,1-6H3 |
| InChIKey | PZIDARWQCOJZFX-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|