About 1-[4,5-bis(ethenyl)-3,6-dihydro-2H-pyridin-1-yl]butan-2-ol;ethane
1-[4,5-bis(ethenyl)-3,6-dihydro-2H-pyridin-1-yl]butan-2-ol;ethane (PubChem CID 142428230) has the molecular formula C15H27NO
and a molecular weight of 237.39 g/mol. Its IUPAC name is 1-[4,5-bis(ethenyl)-3,6-dihydro-2H-pyridin-1-yl]butan-2-ol;ethane.
Molecular Properties
| Compound Name | 1-[4,5-bis(ethenyl)-3,6-dihydro-2H-pyridin-1-yl]butan-2-ol;ethane |
| PubChem CID | 142428230 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | 1-[4,5-bis(ethenyl)-3,6-dihydro-2H-pyridin-1-yl]butan-2-ol;ethane |
| SMILES | C=CC1=C(C=C)CN(CC(O)CC)CC1.CC |
| InChI | InChI=1S/C13H21NO.C2H6/c1-4-11-7-8-14(9-12(11)5-2)10-13(15)6-3;1-2/h4-5,13,15H,1-2,6-10H2,3H3;1-2H3 |
| InChIKey | HYMIPFKNEKLOPT-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[4,5-bis(ethenyl)-3,6-dihydro-2H-pyridin-1-yl]butan-2-ol;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4,5-bis(ethenyl)-3,6-dihydro-2H-pyridin-1-yl]butan-2-ol;ethane?
The IUPAC name of 1-[4,5-bis(ethenyl)-3,6-dihydro-2H-pyridin-1-yl]butan-2-ol;ethane (CID 142428230) is 1-[4,5-bis(ethenyl)-3,6-dihydro-2H-pyridin-1-yl]butan-2-ol;ethane.
What is the SMILES notation for 1-[4,5-bis(ethenyl)-3,6-dihydro-2H-pyridin-1-yl]butan-2-ol;ethane?
The canonical SMILES for 1-[4,5-bis(ethenyl)-3,6-dihydro-2H-pyridin-1-yl]butan-2-ol;ethane is C=CC1=C(C=C)CN(CC(O)CC)CC1.CC.
What is the InChIKey of 1-[4,5-bis(ethenyl)-3,6-dihydro-2H-pyridin-1-yl]butan-2-ol;ethane?
The InChIKey is HYMIPFKNEKLOPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21NO.C2H6/c1-4-11-7-8-14(9-12(11)5-2)10-13(15)6-3;1-2/h4-5,13,15H,1-2,6-10H2,3H3;1-2H3.
What are the key properties of 1-[4,5-bis(ethenyl)-3,6-dihydro-2H-pyridin-1-yl]butan-2-ol;ethane?
1-[4,5-bis(ethenyl)-3,6-dihydro-2H-pyridin-1-yl]butan-2-ol;ethane has a molecular weight of 237.39 g/mol, XLogP of 3.16, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4,5-bis(ethenyl)-3,6-dihydro-2H-pyridin-1-yl]butan-2-ol;ethane is sourced from PubChem (CID 142428230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).