C23H43NO6 — CID 142428408
N-[(5,5-dimethyloxan-2-yl)methyl]-2-[(2R)-2-methoxy-5,6-dimethyl-4-methylideneoxan-2-yl]acetamide;3-methoxypropan-1-ol (PubChem CID 142428408) has the molecular formula C23H43NO6 and a molecular weight of 429.60 g/mol. Its IUPAC name is N-[(5,5-dimethyloxan-2-yl)methyl]-2-[(2R)-2-methoxy-5,6-dimethyl-4-methylideneoxan-2-yl]acetamide;3-methoxypropan-1-ol.
| Compound Name | N-[(5,5-dimethyloxan-2-yl)methyl]-2-[(2R)-2-methoxy-5,6-dimethyl-4-methylideneoxan-2-yl]acetamide;3-methoxypropan-1-ol |
|---|---|
| PubChem CID | 142428408 |
| Molecular Formula | C23H43NO6 |
| Molecular Weight | 429.60 g/mol |
| Exact Mass | 429.31 |
| IUPAC Name | N-[(5,5-dimethyloxan-2-yl)methyl]-2-[(2R)-2-methoxy-5,6-dimethyl-4-methylideneoxan-2-yl]acetamide;3-methoxypropan-1-ol |
| SMILES | C=C1C[C@@](CC(=O)NCC2CCC(C)(C)CO2)(OC)OC(C)C1C.COCCCO |
| InChI | InChI=1S/C19H33NO4.C4H10O2/c1-13-9-19(22-6,24-15(3)14(13)2)10-17(21)20-11-16-7-8-18(4,5)12-23-16;1-6-4-2-3-5/h14-16H,1,7-12H2,2-6H3,(H,20,21);5H,2-4H2,1H3/t14?,15?,16?,19-;/m1./s1 |
| InChIKey | OLDMRNHSBLRPAD-RQXPFVIISA-N |
| XLogP | 3.06 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.60 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|