C19H33NO4 — CID 142428409
N-[(5,5-dimethyloxan-2-yl)methyl]-2-[(2R)-2-methoxy-5,6-dimethyl-4-methylideneoxan-2-yl]acetamide (PubChem CID 142428409) has the molecular formula C19H33NO4 and a molecular weight of 339.48 g/mol. Its IUPAC name is N-[(5,5-dimethyloxan-2-yl)methyl]-2-[(2R)-2-methoxy-5,6-dimethyl-4-methylideneoxan-2-yl]acetamide.
| Compound Name | N-[(5,5-dimethyloxan-2-yl)methyl]-2-[(2R)-2-methoxy-5,6-dimethyl-4-methylideneoxan-2-yl]acetamide |
|---|---|
| PubChem CID | 142428409 |
| Molecular Formula | C19H33NO4 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.24 |
| IUPAC Name | N-[(5,5-dimethyloxan-2-yl)methyl]-2-[(2R)-2-methoxy-5,6-dimethyl-4-methylideneoxan-2-yl]acetamide |
| SMILES | C=C1C[C@@](CC(=O)NCC2CCC(C)(C)CO2)(OC)OC(C)C1C |
| InChI | InChI=1S/C19H33NO4/c1-13-9-19(22-6,24-15(3)14(13)2)10-17(21)20-11-16-7-8-18(4,5)12-23-16/h14-16H,1,7-12H2,2-6H3,(H,20,21)/t14?,15?,16?,19-/m1/s1 |
| InChIKey | XRXSCSJPFFABTA-ZEPBGEJQSA-N |
| XLogP | 3.04 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|