C22H39NO7 — CID 142428417
N-[[6-(2,3-dihydroxypropyl)-4-hydroxy-5,5-dimethyloxan-2-yl]-methoxymethyl]-2-(5,6-dimethyl-4-methylideneoxan-2-yl)acetamide (PubChem CID 142428417) has the molecular formula C22H39NO7 and a molecular weight of 429.55 g/mol. Its IUPAC name is N-[[6-(2,3-dihydroxypropyl)-4-hydroxy-5,5-dimethyloxan-2-yl]-methoxymethyl]-2-(5,6-dimethyl-4-methylideneoxan-2-yl)acetamide.
| Compound Name | N-[[6-(2,3-dihydroxypropyl)-4-hydroxy-5,5-dimethyloxan-2-yl]-methoxymethyl]-2-(5,6-dimethyl-4-methylideneoxan-2-yl)acetamide |
|---|---|
| PubChem CID | 142428417 |
| Molecular Formula | C22H39NO7 |
| Molecular Weight | 429.55 g/mol |
| Exact Mass | 429.27 |
| IUPAC Name | N-[[6-(2,3-dihydroxypropyl)-4-hydroxy-5,5-dimethyloxan-2-yl]-methoxymethyl]-2-(5,6-dimethyl-4-methylideneoxan-2-yl)acetamide |
| SMILES | C=C1CC(CC(=O)NC(OC)C2CC(O)C(C)(C)C(CC(O)CO)O2)OC(C)C1C |
| InChI | InChI=1S/C22H39NO7/c1-12-7-16(29-14(3)13(12)2)9-20(27)23-21(28-6)17-10-18(26)22(4,5)19(30-17)8-15(25)11-24/h13-19,21,24-26H,1,7-11H2,2-6H3,(H,23,27) |
| InChIKey | OBUNMDXTKMIXGA-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 117.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.55 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|