C23H43NO7 — CID 142428421
N-[[(3R)-3-(hydroxymethoxy)-5,5-dimethyloxan-2-yl]methyl]-2-[(2R)-2-methoxy-5,6-dimethyl-4-methylideneoxan-2-yl]acetamide;propan-1-ol (PubChem CID 142428421) has the molecular formula C23H43NO7 and a molecular weight of 445.60 g/mol. Its IUPAC name is N-[[(3R)-3-(hydroxymethoxy)-5,5-dimethyloxan-2-yl]methyl]-2-[(2R)-2-methoxy-5,6-dimethyl-4-methylideneoxan-2-yl]acetamide;propan-1-ol.
| Compound Name | N-[[(3R)-3-(hydroxymethoxy)-5,5-dimethyloxan-2-yl]methyl]-2-[(2R)-2-methoxy-5,6-dimethyl-4-methylideneoxan-2-yl]acetamide;propan-1-ol |
|---|---|
| PubChem CID | 142428421 |
| Molecular Formula | C23H43NO7 |
| Molecular Weight | 445.60 g/mol |
| Exact Mass | 445.30 |
| IUPAC Name | N-[[(3R)-3-(hydroxymethoxy)-5,5-dimethyloxan-2-yl]methyl]-2-[(2R)-2-methoxy-5,6-dimethyl-4-methylideneoxan-2-yl]acetamide;propan-1-ol |
| SMILES | C=C1C[C@@](CC(=O)NCC2OCC(C)(C)C[C@H]2OCO)(OC)OC(C)C1C.CCCO |
| InChI | InChI=1S/C20H35NO6.C3H8O/c1-13-7-20(24-6,27-15(3)14(13)2)9-18(23)21-10-17-16(26-12-22)8-19(4,5)11-25-17;1-2-3-4/h14-17,22H,1,7-12H2,2-6H3,(H,21,23);4H,2-3H2,1H3/t14?,15?,16-,17?,20-;/m1./s1 |
| InChIKey | IYNLEHVAEFYSBP-HKWHYUJOSA-N |
| XLogP | 2.38 |
| TPSA | 106.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.60 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|