C26H35N7O3 — CID 142428492
6-[(1-acetylpiperidin-4-yl)amino]pyrimidine-4-carboxamide;1-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)propan-2-ol (PubChem CID 142428492) has the molecular formula C26H35N7O3 and a molecular weight of 493.61 g/mol. Its IUPAC name is 6-[(1-acetylpiperidin-4-yl)amino]pyrimidine-4-carboxamide;1-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)propan-2-ol.
| Compound Name | 6-[(1-acetylpiperidin-4-yl)amino]pyrimidine-4-carboxamide;1-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)propan-2-ol |
|---|---|
| PubChem CID | 142428492 |
| Molecular Formula | C26H35N7O3 |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.28 |
| IUPAC Name | 6-[(1-acetylpiperidin-4-yl)amino]pyrimidine-4-carboxamide;1-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)propan-2-ol |
| SMILES | CC(=O)N1CCC(Nc2cc(C(N)=O)ncn2)CC1.CC(O)CN1CCc2c([nH]c3ccccc23)C1 |
| InChI | InChI=1S/C14H18N2O.C12H17N5O2/c1-10(17)8-16-7-6-12-11-4-2-3-5-13(11)15-14(12)9-16;1-8(18)17-4-2-9(3-5-17)16-11-6-10(12(13)19)14-7-15-11/h2-5,10,15,17H,6-9H2,1H3;6-7,9H,2-5H2,1H3,(H2,13,19)(H,14,15,16) |
| InChIKey | GUWAIWWNYKXUNZ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 140.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|