C34H32F3N5O5 — CID 142428821
tert-butyl 4-[[1-[3-[methyl-(2-methyl-[1,3]oxazolo[4,5-b]pyridin-6-yl)carbamoyl]phenyl]-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-7-yl]oxy]benzoate (PubChem CID 142428821) has the molecular formula C34H32F3N5O5 and a molecular weight of 647.65 g/mol. Its IUPAC name is tert-butyl 4-[[1-[3-[methyl-(2-methyl-[1,3]oxazolo[4,5-b]pyridin-6-yl)carbamoyl]phenyl]-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-7-yl]oxy]benzoate.
| Compound Name | tert-butyl 4-[[1-[3-[methyl-(2-methyl-[1,3]oxazolo[4,5-b]pyridin-6-yl)carbamoyl]phenyl]-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-7-yl]oxy]benzoate |
|---|---|
| PubChem CID | 142428821 |
| Molecular Formula | C34H32F3N5O5 |
| Molecular Weight | 647.65 g/mol |
| Exact Mass | 647.24 |
| IUPAC Name | tert-butyl 4-[[1-[3-[methyl-(2-methyl-[1,3]oxazolo[4,5-b]pyridin-6-yl)carbamoyl]phenyl]-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-7-yl]oxy]benzoate |
| SMILES | Cc1nc2ncc(N(C)C(=O)c3cccc(-n4nc(C(F)(F)F)c5c4C(Oc4ccc(C(=O)OC(C)(C)C)cc4)CCC5)c3)cc2o1 |
| InChI | InChI=1S/C34H32F3N5O5/c1-19-39-30-27(45-19)17-23(18-38-30)41(5)31(43)21-8-6-9-22(16-21)42-28-25(29(40-42)34(35,36)37)10-7-11-26(28)46-24-14-12-20(13-15-24)32(44)47-33(2,3)4/h6,8-9,12-18,26H,7,10-11H2,1-5H3 |
| InChIKey | XWHQMLOXPYDTEW-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 112.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.65 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |