C23H22FN7O3 — CID 142429756
N-[4-fluoro-3-[2-[[1-(oxan-4-yl)pyrazol-4-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-4-yl]oxyphenyl]prop-2-enamide (PubChem CID 142429756) has the molecular formula C23H22FN7O3 and a molecular weight of 463.47 g/mol. Its IUPAC name is N-[4-fluoro-3-[2-[[1-(oxan-4-yl)pyrazol-4-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-4-yl]oxyphenyl]prop-2-enamide.
| Compound Name | N-[4-fluoro-3-[2-[[1-(oxan-4-yl)pyrazol-4-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-4-yl]oxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 142429756 |
| Molecular Formula | C23H22FN7O3 |
| Molecular Weight | 463.47 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | N-[4-fluoro-3-[2-[[1-(oxan-4-yl)pyrazol-4-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-4-yl]oxyphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(F)c(Oc2nc(Nc3cnn(C4CCOCC4)c3)nn3cccc23)c1 |
| InChI | InChI=1S/C23H22FN7O3/c1-2-21(32)26-15-5-6-18(24)20(12-15)34-22-19-4-3-9-30(19)29-23(28-22)27-16-13-25-31(14-16)17-7-10-33-11-8-17/h2-6,9,12-14,17H,1,7-8,10-11H2,(H,26,32)(H,27,29) |
| InChIKey | GEGAVKHDOZWMBJ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 107.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.47 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|