C14H10N4O2 — CID 142429861
4-nitro-11,15,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),3,5,12,14,16-heptaene (PubChem CID 142429861) has the molecular formula C14H10N4O2 and a molecular weight of 266.26 g/mol. Its IUPAC name is 4-nitro-11,15,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),3,5,12,14,16-heptaene.
| Compound Name | 4-nitro-11,15,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),3,5,12,14,16-heptaene |
|---|---|
| PubChem CID | 142429861 |
| Molecular Formula | C14H10N4O2 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 4-nitro-11,15,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),3,5,12,14,16-heptaene |
| SMILES | O=[N+]([O-])c1ccc2c(c1)-c1nc3ncccn3c1CC2 |
| InChI | InChI=1S/C14H10N4O2/c19-18(20)10-4-2-9-3-5-12-13(11(9)8-10)16-14-15-6-1-7-17(12)14/h1-2,4,6-8H,3,5H2 |
| InChIKey | IPYUHYFTCITHGS-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|