C22H21F3N4O3 — CID 142430058
(5-carbamoyl-3-pyridinyl) (2R)-2-ethynyl-4-[[2-methyl-3-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate (PubChem CID 142430058) has the molecular formula C22H21F3N4O3 and a molecular weight of 446.43 g/mol. Its IUPAC name is (5-carbamoyl-3-pyridinyl) (2R)-2-ethynyl-4-[[2-methyl-3-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate.
| Compound Name | (5-carbamoyl-3-pyridinyl) (2R)-2-ethynyl-4-[[2-methyl-3-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 142430058 |
| Molecular Formula | C22H21F3N4O3 |
| Molecular Weight | 446.43 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | (5-carbamoyl-3-pyridinyl) (2R)-2-ethynyl-4-[[2-methyl-3-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate |
| SMILES | C#C[C@@H]1CN(Cc2cccc(C(F)(F)F)c2C)CCN1C(=O)Oc1cncc(C(N)=O)c1 |
| InChI | InChI=1S/C22H21F3N4O3/c1-3-17-13-28(12-15-5-4-6-19(14(15)2)22(23,24)25)7-8-29(17)21(31)32-18-9-16(20(26)30)10-27-11-18/h1,4-6,9-11,17H,7-8,12-13H2,2H3,(H2,26,30)/t17-/m1/s1 |
| InChIKey | ZQEAZPONBBQKOM-QGZVFWFLSA-N |
| XLogP | 2.83 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.43 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|