About 5-[(1Z)-1-methylsulfanylbuta-1,3-dienyl]thiolan-3-one
5-[(1Z)-1-methylsulfanylbuta-1,3-dienyl]thiolan-3-one (PubChem CID 142430119) has the molecular formula C9H12OS2
and a molecular weight of 200.33 g/mol. Its IUPAC name is 5-[(1Z)-1-methylsulfanylbuta-1,3-dienyl]thiolan-3-one.
Molecular Properties
| Compound Name | 5-[(1Z)-1-methylsulfanylbuta-1,3-dienyl]thiolan-3-one |
| PubChem CID | 142430119 |
| Molecular Formula | C9H12OS2 |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.03 |
| IUPAC Name | 5-[(1Z)-1-methylsulfanylbuta-1,3-dienyl]thiolan-3-one |
| SMILES | C=C/C=C(\SC)C1CC(=O)CS1 |
| InChI | InChI=1S/C9H12OS2/c1-3-4-8(11-2)9-5-7(10)6-12-9/h3-4,9H,1,5-6H2,2H3/b8-4- |
| InChIKey | MMLXJSHOKDWDLE-YWEYNIOJSA-N |
| XLogP | 2.49 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 5-[(1Z)-1-methylsulfanylbuta-1,3-dienyl]thiolan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(1Z)-1-methylsulfanylbuta-1,3-dienyl]thiolan-3-one?
The IUPAC name of 5-[(1Z)-1-methylsulfanylbuta-1,3-dienyl]thiolan-3-one (CID 142430119) is 5-[(1Z)-1-methylsulfanylbuta-1,3-dienyl]thiolan-3-one.
What is the SMILES notation for 5-[(1Z)-1-methylsulfanylbuta-1,3-dienyl]thiolan-3-one?
The canonical SMILES for 5-[(1Z)-1-methylsulfanylbuta-1,3-dienyl]thiolan-3-one is C=C/C=C(\SC)C1CC(=O)CS1.
What is the InChIKey of 5-[(1Z)-1-methylsulfanylbuta-1,3-dienyl]thiolan-3-one?
The InChIKey is MMLXJSHOKDWDLE-YWEYNIOJSA-N. The full InChI is InChI=1S/C9H12OS2/c1-3-4-8(11-2)9-5-7(10)6-12-9/h3-4,9H,1,5-6H2,2H3/b8-4-.
What are the key properties of 5-[(1Z)-1-methylsulfanylbuta-1,3-dienyl]thiolan-3-one?
5-[(1Z)-1-methylsulfanylbuta-1,3-dienyl]thiolan-3-one has a molecular weight of 200.33 g/mol, XLogP of 2.49, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(1Z)-1-methylsulfanylbuta-1,3-dienyl]thiolan-3-one is sourced from PubChem (CID 142430119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).