C36H46IN3O4S — CID 142431219
N-[3-(2-cyclopropyl-1,3-thiazol-5-yl)phenyl]-1-(2-hydroxypropanoylamino)-N-[[4-(4-methoxy-3-methylphenyl)cyclohexyl]methyl]-1λ3-iodinane-4-carboxamide (PubChem CID 142431219) has the molecular formula C36H46IN3O4S and a molecular weight of 743.75 g/mol. Its IUPAC name is N-[3-(2-cyclopropyl-1,3-thiazol-5-yl)phenyl]-1-(2-hydroxypropanoylamino)-N-[[4-(4-methoxy-3-methylphenyl)cyclohexyl]methyl]-1λ3-iodinane-4-carboxamide.
| Compound Name | N-[3-(2-cyclopropyl-1,3-thiazol-5-yl)phenyl]-1-(2-hydroxypropanoylamino)-N-[[4-(4-methoxy-3-methylphenyl)cyclohexyl]methyl]-1λ3-iodinane-4-carboxamide |
|---|---|
| PubChem CID | 142431219 |
| Molecular Formula | C36H46IN3O4S |
| Molecular Weight | 743.75 g/mol |
| Exact Mass | 743.23 |
| IUPAC Name | N-[3-(2-cyclopropyl-1,3-thiazol-5-yl)phenyl]-1-(2-hydroxypropanoylamino)-N-[[4-(4-methoxy-3-methylphenyl)cyclohexyl]methyl]-1λ3-iodinane-4-carboxamide |
| SMILES | COc1ccc(C2CCC(CN(C(=O)C3CCI(NC(=O)C(C)O)CC3)c3cccc(-c4cnc(C5CC5)s4)c3)CC2)cc1C |
| InChI | InChI=1S/C36H46IN3O4S/c1-23-19-29(13-14-32(23)44-3)26-9-7-25(8-10-26)22-40(36(43)28-15-17-37(18-16-28)39-34(42)24(2)41)31-6-4-5-30(20-31)33-21-38-35(45-33)27-11-12-27/h4-6,13-14,19-21,24-28,41H,7-12,15-18,22H2,1-3H3,(H,39,42) |
| InChIKey | FCFYGKOTIYBBSI-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.75 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|