C22H21ClN6O3S — CID 142431414
(15S)-5-[[4-chloro-6-(2-methoxyethoxy)pyrimidin-2-yl]amino]-15-methyl-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-13-one (PubChem CID 142431414) has the molecular formula C22H21ClN6O3S and a molecular weight of 484.97 g/mol. Its IUPAC name is (15S)-5-[[4-chloro-6-(2-methoxyethoxy)pyrimidin-2-yl]amino]-15-methyl-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-13-one.
| Compound Name | (15S)-5-[[4-chloro-6-(2-methoxyethoxy)pyrimidin-2-yl]amino]-15-methyl-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-13-one |
|---|---|
| PubChem CID | 142431414 |
| Molecular Formula | C22H21ClN6O3S |
| Molecular Weight | 484.97 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | (15S)-5-[[4-chloro-6-(2-methoxyethoxy)pyrimidin-2-yl]amino]-15-methyl-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-13-one |
| SMILES | COCCOc1cc(Cl)nc(Nc2ccc3c(ccc4sc5c(c43)NC[C@H](C)NC5=O)n2)n1 |
| InChI | InChI=1S/C22H21ClN6O3S/c1-11-10-24-19-18-12-3-6-16(26-13(12)4-5-14(18)33-20(19)21(30)25-11)28-22-27-15(23)9-17(29-22)32-8-7-31-2/h3-6,9,11,24H,7-8,10H2,1-2H3,(H,25,30)(H,26,27,28,29)/t11-/m0/s1 |
| InChIKey | APTIJGYCIBCMCO-NSHDSACASA-N |
| XLogP | 4.21 |
| TPSA | 110.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.97 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|