C26H43N — CID 142431551
ethene;1-[(3Z)-3-ethylhexa-3,5-dienyl]-4-[(3Z,4Z)-5-methyl-3-propylidenehepta-4,6-dienyl]piperidine (PubChem CID 142431551) has the molecular formula C26H43N and a molecular weight of 369.64 g/mol. Its IUPAC name is ethene;1-[(3Z)-3-ethylhexa-3,5-dienyl]-4-[(3Z,4Z)-5-methyl-3-propylidenehepta-4,6-dienyl]piperidine.
| Compound Name | ethene;1-[(3Z)-3-ethylhexa-3,5-dienyl]-4-[(3Z,4Z)-5-methyl-3-propylidenehepta-4,6-dienyl]piperidine |
|---|---|
| PubChem CID | 142431551 |
| Molecular Formula | C26H43N |
| Molecular Weight | 369.64 g/mol |
| Exact Mass | 369.34 |
| IUPAC Name | ethene;1-[(3Z)-3-ethylhexa-3,5-dienyl]-4-[(3Z,4Z)-5-methyl-3-propylidenehepta-4,6-dienyl]piperidine |
| SMILES | C=C.C=C/C=C(/CC)CCN1CCC(CCC(/C=C(/C)C=C)=C/CC)CC1 |
| InChI | InChI=1S/C24H39N.C2H4/c1-6-10-22(9-4)14-17-25-18-15-23(16-19-25)12-13-24(11-7-2)20-21(5)8-3;1-2/h6,8,10-11,20,23H,1,3,7,9,12-19H2,2,4-5H3;1-2H2/b21-20-,22-10-,24-11-; |
| InChIKey | MNMVYOSDDACNAN-HXCPXZJSSA-N |
| XLogP | 7.66 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.64 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|