C20H22FIN2O4S — CID 142431626
methyl 5-[(2-fluoro-3-iodo-6-methyl-5,5-dioxo-11H-benzo[c][1,2]benzothiazepin-11-yl)amino]pentanoate (PubChem CID 142431626) has the molecular formula C20H22FIN2O4S and a molecular weight of 532.38 g/mol. Its IUPAC name is methyl 5-[(2-fluoro-3-iodo-6-methyl-5,5-dioxo-11H-benzo[c][1,2]benzothiazepin-11-yl)amino]pentanoate.
| Compound Name | methyl 5-[(2-fluoro-3-iodo-6-methyl-5,5-dioxo-11H-benzo[c][1,2]benzothiazepin-11-yl)amino]pentanoate |
|---|---|
| PubChem CID | 142431626 |
| Molecular Formula | C20H22FIN2O4S |
| Molecular Weight | 532.38 g/mol |
| Exact Mass | 532.03 |
| IUPAC Name | methyl 5-[(2-fluoro-3-iodo-6-methyl-5,5-dioxo-11H-benzo[c][1,2]benzothiazepin-11-yl)amino]pentanoate |
| SMILES | COC(=O)CCCCNC1c2ccccc2N(C)S(=O)(=O)c2cc(I)c(F)cc21 |
| InChI | InChI=1S/C20H22FIN2O4S/c1-24-17-8-4-3-7-13(17)20(23-10-6-5-9-19(25)28-2)14-11-15(21)16(22)12-18(14)29(24,26)27/h3-4,7-8,11-12,20,23H,5-6,9-10H2,1-2H3 |
| InChIKey | VHGJKXIYHHYPSP-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.38 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|