C20H23FN2O4S — CID 142431645
5-[(2-fluoro-3,6-dimethyl-5,5-dioxo-11H-benzo[c][1,2]benzothiazepin-11-yl)amino]pentanoic acid (PubChem CID 142431645) has the molecular formula C20H23FN2O4S and a molecular weight of 406.48 g/mol. Its IUPAC name is 5-[(2-fluoro-3,6-dimethyl-5,5-dioxo-11H-benzo[c][1,2]benzothiazepin-11-yl)amino]pentanoic acid.
| Compound Name | 5-[(2-fluoro-3,6-dimethyl-5,5-dioxo-11H-benzo[c][1,2]benzothiazepin-11-yl)amino]pentanoic acid |
|---|---|
| PubChem CID | 142431645 |
| Molecular Formula | C20H23FN2O4S |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 5-[(2-fluoro-3,6-dimethyl-5,5-dioxo-11H-benzo[c][1,2]benzothiazepin-11-yl)amino]pentanoic acid |
| SMILES | Cc1cc2c(cc1F)C(NCCCCC(=O)O)c1ccccc1N(C)S2(=O)=O |
| InChI | InChI=1S/C20H23FN2O4S/c1-13-11-18-15(12-16(13)21)20(22-10-6-5-9-19(24)25)14-7-3-4-8-17(14)23(2)28(18,26)27/h3-4,7-8,11-12,20,22H,5-6,9-10H2,1-2H3,(H,24,25) |
| InChIKey | ZOMHECIIMSGPGG-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|