About 11-chloro-3,6-dimethyl-11H-benzo[c][2,1]benzothiazepine;ethane
11-chloro-3,6-dimethyl-11H-benzo[c][2,1]benzothiazepine;ethane (PubChem CID 142431714) has the molecular formula C17H20ClNS
and a molecular weight of 305.87 g/mol. Its IUPAC name is 11-chloro-3,6-dimethyl-11H-benzo[c][2,1]benzothiazepine;ethane.
Molecular Properties
| Compound Name | 11-chloro-3,6-dimethyl-11H-benzo[c][2,1]benzothiazepine;ethane |
| PubChem CID | 142431714 |
| Molecular Formula | C17H20ClNS |
| Molecular Weight | 305.87 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 11-chloro-3,6-dimethyl-11H-benzo[c][2,1]benzothiazepine;ethane |
| SMILES | CC.Cc1ccc2c(c1)SN(C)c1ccccc1C2Cl |
| InChI | InChI=1S/C15H14ClNS.C2H6/c1-10-7-8-12-14(9-10)18-17(2)13-6-4-3-5-11(13)15(12)16;1-2/h3-9,15H,1-2H3;1-2H3 |
| InChIKey | FOKDCIZCVXZLKT-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 305.87 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 11-chloro-3,6-dimethyl-11H-benzo[c][2,1]benzothiazepine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-chloro-3,6-dimethyl-11H-benzo[c][2,1]benzothiazepine;ethane?
The IUPAC name of 11-chloro-3,6-dimethyl-11H-benzo[c][2,1]benzothiazepine;ethane (CID 142431714) is 11-chloro-3,6-dimethyl-11H-benzo[c][2,1]benzothiazepine;ethane.
What is the SMILES notation for 11-chloro-3,6-dimethyl-11H-benzo[c][2,1]benzothiazepine;ethane?
The canonical SMILES for 11-chloro-3,6-dimethyl-11H-benzo[c][2,1]benzothiazepine;ethane is CC.Cc1ccc2c(c1)SN(C)c1ccccc1C2Cl.
What is the InChIKey of 11-chloro-3,6-dimethyl-11H-benzo[c][2,1]benzothiazepine;ethane?
The InChIKey is FOKDCIZCVXZLKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14ClNS.C2H6/c1-10-7-8-12-14(9-10)18-17(2)13-6-4-3-5-11(13)15(12)16;1-2/h3-9,15H,1-2H3;1-2H3.
What are the key properties of 11-chloro-3,6-dimethyl-11H-benzo[c][2,1]benzothiazepine;ethane?
11-chloro-3,6-dimethyl-11H-benzo[c][2,1]benzothiazepine;ethane has a molecular weight of 305.87 g/mol, XLogP of 5.81, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 11-chloro-3,6-dimethyl-11H-benzo[c][2,1]benzothiazepine;ethane is sourced from PubChem (CID 142431714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).