About 3-cyano-1,1-dimethyl-2-propylguanidine
3-cyano-1,1-dimethyl-2-propylguanidine (PubChem CID 142431892) has the molecular formula C7H14N4
and a molecular weight of 154.22 g/mol. Its IUPAC name is 3-cyano-1,1-dimethyl-2-propylguanidine.
Molecular Properties
| Compound Name | 3-cyano-1,1-dimethyl-2-propylguanidine |
| PubChem CID | 142431892 |
| Molecular Formula | C7H14N4 |
| Molecular Weight | 154.22 g/mol |
| Exact Mass | 154.12 |
| IUPAC Name | 3-cyano-1,1-dimethyl-2-propylguanidine |
| SMILES | CCC/N=C(/NC#N)N(C)C |
| InChI | InChI=1S/C7H14N4/c1-4-5-9-7(10-6-8)11(2)3/h4-5H2,1-3H3,(H,9,10) |
| InChIKey | QSGMONHQGQJMBW-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 51.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.22 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-cyano-1,1-dimethyl-2-propylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyano-1,1-dimethyl-2-propylguanidine?
The IUPAC name of 3-cyano-1,1-dimethyl-2-propylguanidine (CID 142431892) is 3-cyano-1,1-dimethyl-2-propylguanidine.
What is the SMILES notation for 3-cyano-1,1-dimethyl-2-propylguanidine?
The canonical SMILES for 3-cyano-1,1-dimethyl-2-propylguanidine is CCC/N=C(/NC#N)N(C)C.
What is the InChIKey of 3-cyano-1,1-dimethyl-2-propylguanidine?
The InChIKey is QSGMONHQGQJMBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N4/c1-4-5-9-7(10-6-8)11(2)3/h4-5H2,1-3H3,(H,9,10).
What are the key properties of 3-cyano-1,1-dimethyl-2-propylguanidine?
3-cyano-1,1-dimethyl-2-propylguanidine has a molecular weight of 154.22 g/mol, XLogP of 0.38, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyano-1,1-dimethyl-2-propylguanidine is sourced from PubChem (CID 142431892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).