C22H27FS — CID 142432096
6-(fluoromethylsulfanyl)-12-methyl-15-methylidenepentacyclo[9.8.0.02,8.05,8.012,17]nonadeca-6,13,16-triene (PubChem CID 142432096) has the molecular formula C22H27FS and a molecular weight of 342.52 g/mol. Its IUPAC name is 6-(fluoromethylsulfanyl)-12-methyl-15-methylidenepentacyclo[9.8.0.02,8.05,8.012,17]nonadeca-6,13,16-triene.
| Compound Name | 6-(fluoromethylsulfanyl)-12-methyl-15-methylidenepentacyclo[9.8.0.02,8.05,8.012,17]nonadeca-6,13,16-triene |
|---|---|
| PubChem CID | 142432096 |
| Molecular Formula | C22H27FS |
| Molecular Weight | 342.52 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 6-(fluoromethylsulfanyl)-12-methyl-15-methylidenepentacyclo[9.8.0.02,8.05,8.012,17]nonadeca-6,13,16-triene |
| SMILES | C=C1C=CC2(C)C(=C1)CCC1C2CCC23C=C(SCF)C2CCC13 |
| InChI | InChI=1S/C22H27FS/c1-14-7-9-21(2)15(11-14)3-4-16-17(21)8-10-22-12-20(24-13-23)19(22)6-5-18(16)22/h7,9,11-12,16-19H,1,3-6,8,10,13H2,2H3 |
| InChIKey | LCEKTUFMTWEFAH-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.52 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |