C21H21F3N4O3 — CID 142432343
6-[4,8-dimethyl-3-(3-methyl-1,2,4-oxadiazol-5-yl)-6-(2,2,2-trifluoroethyl)quinolin-2-yl]-1,2-dioxa-6-azaspiro[2.5]octane (PubChem CID 142432343) has the molecular formula C21H21F3N4O3 and a molecular weight of 434.42 g/mol. Its IUPAC name is 6-[4,8-dimethyl-3-(3-methyl-1,2,4-oxadiazol-5-yl)-6-(2,2,2-trifluoroethyl)quinolin-2-yl]-1,2-dioxa-6-azaspiro[2.5]octane.
| Compound Name | 6-[4,8-dimethyl-3-(3-methyl-1,2,4-oxadiazol-5-yl)-6-(2,2,2-trifluoroethyl)quinolin-2-yl]-1,2-dioxa-6-azaspiro[2.5]octane |
|---|---|
| PubChem CID | 142432343 |
| Molecular Formula | C21H21F3N4O3 |
| Molecular Weight | 434.42 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 6-[4,8-dimethyl-3-(3-methyl-1,2,4-oxadiazol-5-yl)-6-(2,2,2-trifluoroethyl)quinolin-2-yl]-1,2-dioxa-6-azaspiro[2.5]octane |
| SMILES | Cc1noc(-c2c(N3CCC4(CC3)OO4)nc3c(C)cc(CC(F)(F)F)cc3c2C)n1 |
| InChI | InChI=1S/C21H21F3N4O3/c1-11-8-14(10-21(22,23)24)9-15-12(2)16(19-25-13(3)27-29-19)18(26-17(11)15)28-6-4-20(5-7-28)30-31-20/h8-9H,4-7,10H2,1-3H3 |
| InChIKey | JEIWYSJCECTLOO-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 80.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.42 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|